C20H40N2O6P+ — CID 56619208
(1S)-1-[6-amino-2-[hydroxy(octyl)phosphoryl]oxyhexanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 56619208) has the molecular formula C20H40N2O6P+ and a molecular weight of 435.52 g/mol. Its IUPAC name is (1S)-1-[6-amino-2-[hydroxy(octyl)phosphoryl]oxyhexanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (1S)-1-[6-amino-2-[hydroxy(octyl)phosphoryl]oxyhexanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 56619208 |
| Molecular Formula | C20H40N2O6P+ |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | (1S)-1-[6-amino-2-[hydroxy(octyl)phosphoryl]oxyhexanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | CCCCCCCCP(=O)(O)OC(CCCCN)C(=O)[N@+]1(C(=O)O)CCCC1C |
| InChI | InChI=1S/C20H39N2O6P/c1-3-4-5-6-7-10-16-29(26,27)28-18(13-8-9-14-21)19(23)22(20(24)25)15-11-12-17(22)2/h17-18H,3-16,21H2,1-2H3,(H-,24,25,26,27)/p+1/t17?,18?,22-/m0/s1 |
| InChIKey | MGGPRNBAMJTBJW-IRZJEQJZSA-O |
| XLogP | 4.25 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|