C19H39N2O6P — CID 88609794
(2S)-1-[6-amino-1-hydroxy-2-[hydroxy(octyl)phosphoryl]oxyhexyl]pyrrolidine-2-carboxylic acid (PubChem CID 88609794) has the molecular formula C19H39N2O6P and a molecular weight of 422.50 g/mol. Its IUPAC name is (2S)-1-[6-amino-1-hydroxy-2-[hydroxy(octyl)phosphoryl]oxyhexyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[6-amino-1-hydroxy-2-[hydroxy(octyl)phosphoryl]oxyhexyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 88609794 |
| Molecular Formula | C19H39N2O6P |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | (2S)-1-[6-amino-1-hydroxy-2-[hydroxy(octyl)phosphoryl]oxyhexyl]pyrrolidine-2-carboxylic acid |
| SMILES | CCCCCCCCP(=O)(O)OC(CCCCN)C(O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C19H39N2O6P/c1-2-3-4-5-6-9-15-28(25,26)27-17(12-7-8-13-20)18(22)21-14-10-11-16(21)19(23)24/h16-18,22H,2-15,20H2,1H3,(H,23,24)(H,25,26)/t16-,17?,18?/m0/s1 |
| InChIKey | VKLXTYPWYBOBKJ-AOCRQIFASA-N |
| XLogP | 2.91 |
| TPSA | 133.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|