C21H40N2O8P+ — CID 57311200
(2R)-1-[6-amino-2-[[(1S)-1-butanoyloxypentyl]-hydroxyphosphoryl]oxyhexanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57311200) has the molecular formula C21H40N2O8P+ and a molecular weight of 479.53 g/mol. Its IUPAC name is (2R)-1-[6-amino-2-[[(1S)-1-butanoyloxypentyl]-hydroxyphosphoryl]oxyhexanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-1-[6-amino-2-[[(1S)-1-butanoyloxypentyl]-hydroxyphosphoryl]oxyhexanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57311200 |
| Molecular Formula | C21H40N2O8P+ |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | (2R)-1-[6-amino-2-[[(1S)-1-butanoyloxypentyl]-hydroxyphosphoryl]oxyhexanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | CCCC[C@@H](OC(=O)CCC)P(=O)(O)OC(CCCCN)C(=O)[N+]1(C(=O)O)CCC[C@H]1C |
| InChI | InChI=1S/C21H39N2O8P/c1-4-6-13-19(30-18(24)10-5-2)32(28,29)31-17(12-7-8-14-22)20(25)23(21(26)27)15-9-11-16(23)3/h16-17,19H,4-15,22H2,1-3H3,(H-,26,27,28,29)/p+1/t16-,17?,19+,23?/m1/s1 |
| InChIKey | ONIKEPCJGCAPBN-DVCDAGAOSA-O |
| XLogP | 3.75 |
| TPSA | 153.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|