C23H37NO5S — CID 11553966
cyclohexyl (3R)-3-(phenylmethoxycarbonylamino)nonane-1-sulfonate (PubChem CID 11553966) has the molecular formula C23H37NO5S and a molecular weight of 439.62 g/mol. Its IUPAC name is cyclohexyl (3R)-3-(phenylmethoxycarbonylamino)nonane-1-sulfonate.
| Compound Name | cyclohexyl (3R)-3-(phenylmethoxycarbonylamino)nonane-1-sulfonate |
|---|---|
| PubChem CID | 11553966 |
| Molecular Formula | C23H37NO5S |
| Molecular Weight | 439.62 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | cyclohexyl (3R)-3-(phenylmethoxycarbonylamino)nonane-1-sulfonate |
| SMILES | CCCCCC[C@H](CCS(=O)(=O)OC1CCCCC1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H37NO5S/c1-2-3-4-9-14-21(24-23(25)28-19-20-12-7-5-8-13-20)17-18-30(26,27)29-22-15-10-6-11-16-22/h5,7-8,12-13,21-22H,2-4,6,9-11,14-19H2,1H3,(H,24,25)/t21-/m1/s1 |
| InChIKey | IQWYSJSUOXMJRL-OAQYLSRUSA-N |
| XLogP | 5.32 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.62 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|