C18H27NO5S — CID 11603120
cyclohexyl (3R)-3-(phenylmethoxycarbonylamino)butane-1-sulfonate (PubChem CID 11603120) has the molecular formula C18H27NO5S and a molecular weight of 369.48 g/mol. Its IUPAC name is cyclohexyl (3R)-3-(phenylmethoxycarbonylamino)butane-1-sulfonate.
| Compound Name | cyclohexyl (3R)-3-(phenylmethoxycarbonylamino)butane-1-sulfonate |
|---|---|
| PubChem CID | 11603120 |
| Molecular Formula | C18H27NO5S |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | cyclohexyl (3R)-3-(phenylmethoxycarbonylamino)butane-1-sulfonate |
| SMILES | C[C@H](CCS(=O)(=O)OC1CCCCC1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H27NO5S/c1-15(19-18(20)23-14-16-8-4-2-5-9-16)12-13-25(21,22)24-17-10-6-3-7-11-17/h2,4-5,8-9,15,17H,3,6-7,10-14H2,1H3,(H,19,20)/t15-/m1/s1 |
| InChIKey | MNPDOJCBJLLPRZ-OAHLLOKOSA-N |
| XLogP | 3.37 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|