C22H33NO5 — CID 102081203
ethyl (5R)-3-oxo-5-(phenylmethoxycarbonylamino)dodecanoate (PubChem CID 102081203) has the molecular formula C22H33NO5 and a molecular weight of 391.51 g/mol. Its IUPAC name is ethyl (5R)-3-oxo-5-(phenylmethoxycarbonylamino)dodecanoate.
| Compound Name | ethyl (5R)-3-oxo-5-(phenylmethoxycarbonylamino)dodecanoate |
|---|---|
| PubChem CID | 102081203 |
| Molecular Formula | C22H33NO5 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | ethyl (5R)-3-oxo-5-(phenylmethoxycarbonylamino)dodecanoate |
| SMILES | CCCCCCC[C@H](CC(=O)CC(=O)OCC)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H33NO5/c1-3-5-6-7-11-14-19(15-20(24)16-21(25)27-4-2)23-22(26)28-17-18-12-9-8-10-13-18/h8-10,12-13,19H,3-7,11,14-17H2,1-2H3,(H,23,26)/t19-/m1/s1 |
| InChIKey | STKTUVLFYHXTAR-LJQANCHMSA-N |
| XLogP | 4.55 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|