C29H38N4O4 — CID 151945723
9H-fluoren-9-ylmethyl N-[(5S)-6-oxo-6-(propan-2-ylamino)-5-[[(2S)-pyrrolidine-2-carbonyl]amino]hexyl]carbamate (PubChem CID 151945723) has the molecular formula C29H38N4O4 and a molecular weight of 506.65 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(5S)-6-oxo-6-(propan-2-ylamino)-5-[[(2S)-pyrrolidine-2-carbonyl]amino]hexyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(5S)-6-oxo-6-(propan-2-ylamino)-5-[[(2S)-pyrrolidine-2-carbonyl]amino]hexyl]carbamate |
|---|---|
| PubChem CID | 151945723 |
| Molecular Formula | C29H38N4O4 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(5S)-6-oxo-6-(propan-2-ylamino)-5-[[(2S)-pyrrolidine-2-carbonyl]amino]hexyl]carbamate |
| SMILES | CC(C)NC(=O)[C@H](CCCCNC(=O)OCC1c2ccccc2-c2ccccc21)NC(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C29H38N4O4/c1-19(2)32-28(35)26(33-27(34)25-15-9-17-30-25)14-7-8-16-31-29(36)37-18-24-22-12-5-3-10-20(22)21-11-4-6-13-23(21)24/h3-6,10-13,19,24-26,30H,7-9,14-18H2,1-2H3,(H,31,36)(H,32,35)(H,33,34)/t25-,26-/m0/s1 |
| InChIKey | TVPFAYXBZLTTKO-UIOOFZCWSA-N |
| XLogP | 3.46 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|