C24H34N4O6 — CID 156628376
methyl (2S)-2-[[(2S)-2-cyclopropyl-2-(pyrrolidine-2-carbonylamino)acetyl]amino]-5-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 156628376) has the molecular formula C24H34N4O6 and a molecular weight of 474.56 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-cyclopropyl-2-(pyrrolidine-2-carbonylamino)acetyl]amino]-5-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | methyl (2S)-2-[[(2S)-2-cyclopropyl-2-(pyrrolidine-2-carbonylamino)acetyl]amino]-5-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 156628376 |
| Molecular Formula | C24H34N4O6 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-cyclopropyl-2-(pyrrolidine-2-carbonylamino)acetyl]amino]-5-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | COC(=O)[C@H](CCCNC(=O)OCc1ccccc1)NC(=O)[C@@H](NC(=O)C1CCCN1)C1CC1 |
| InChI | InChI=1S/C24H34N4O6/c1-33-23(31)19(10-6-14-26-24(32)34-15-16-7-3-2-4-8-16)27-22(30)20(17-11-12-17)28-21(29)18-9-5-13-25-18/h2-4,7-8,17-20,25H,5-6,9-15H2,1H3,(H,26,32)(H,27,30)(H,28,29)/t18?,19-,20-/m0/s1 |
| InChIKey | YYPPMMDZBQVSCZ-YPJRHXLCSA-N |
| XLogP | 1.00 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|