C32H35N5O8 — CID 54063601
benzyl N-[(4S)-5-(4-nitro-N-(2-phenoxyacetyl)anilino)-5-oxo-4-[[(2S)-pyrrolidine-2-carbonyl]amino]pentyl]carbamate (PubChem CID 54063601) has the molecular formula C32H35N5O8 and a molecular weight of 617.66 g/mol. Its IUPAC name is benzyl N-[(4S)-5-(4-nitro-N-(2-phenoxyacetyl)anilino)-5-oxo-4-[[(2S)-pyrrolidine-2-carbonyl]amino]pentyl]carbamate.
| Compound Name | benzyl N-[(4S)-5-(4-nitro-N-(2-phenoxyacetyl)anilino)-5-oxo-4-[[(2S)-pyrrolidine-2-carbonyl]amino]pentyl]carbamate |
|---|---|
| PubChem CID | 54063601 |
| Molecular Formula | C32H35N5O8 |
| Molecular Weight | 617.66 g/mol |
| Exact Mass | 617.25 |
| IUPAC Name | benzyl N-[(4S)-5-(4-nitro-N-(2-phenoxyacetyl)anilino)-5-oxo-4-[[(2S)-pyrrolidine-2-carbonyl]amino]pentyl]carbamate |
| SMILES | O=C(NCCC[C@H](NC(=O)[C@@H]1CCCN1)C(=O)N(C(=O)COc1ccccc1)c1ccc([N+](=O)[O-])cc1)OCc1ccccc1 |
| InChI | InChI=1S/C32H35N5O8/c38-29(22-44-26-11-5-2-6-12-26)36(24-15-17-25(18-16-24)37(42)43)31(40)28(35-30(39)27-13-7-19-33-27)14-8-20-34-32(41)45-21-23-9-3-1-4-10-23/h1-6,9-12,15-18,27-28,33H,7-8,13-14,19-22H2,(H,34,41)(H,35,39)/t27-,28-/m0/s1 |
| InChIKey | MBKUZQWUVXJVFP-NSOVKSMOSA-N |
| XLogP | 3.48 |
| TPSA | 169.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.66 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|