C14H21ClN2O2 — CID 119274134
N-(3-phenoxypropyl)pyrrolidine-2-carboxamide;hydrochloride (PubChem CID 119274134) has the molecular formula C14H21ClN2O2 and a molecular weight of 284.79 g/mol. Its IUPAC name is N-(3-phenoxypropyl)pyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | N-(3-phenoxypropyl)pyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119274134 |
| Molecular Formula | C14H21ClN2O2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | N-(3-phenoxypropyl)pyrrolidine-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCCCOc1ccccc1)C1CCCN1 |
| InChI | InChI=1S/C14H20N2O2.ClH/c17-14(13-8-4-9-15-13)16-10-5-11-18-12-6-2-1-3-7-12;/h1-3,6-7,13,15H,4-5,8-11H2,(H,16,17);1H |
| InChIKey | ZMRGGLFSVNCLNQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|