C16H18F6N2O2 — CID 118661126
N-[3-[3,5-bis(trifluoromethyl)phenoxy]propyl]pyrrolidine-2-carboxamide (PubChem CID 118661126) has the molecular formula C16H18F6N2O2 and a molecular weight of 384.32 g/mol. Its IUPAC name is N-[3-[3,5-bis(trifluoromethyl)phenoxy]propyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[3-[3,5-bis(trifluoromethyl)phenoxy]propyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 118661126 |
| Molecular Formula | C16H18F6N2O2 |
| Molecular Weight | 384.32 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | N-[3-[3,5-bis(trifluoromethyl)phenoxy]propyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(NCCCOc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C1CCCN1 |
| InChI | InChI=1S/C16H18F6N2O2/c17-15(18,19)10-7-11(16(20,21)22)9-12(8-10)26-6-2-5-24-14(25)13-3-1-4-23-13/h7-9,13,23H,1-6H2,(H,24,25) |
| InChIKey | OYFSRMPGXBPUNO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|