C25H31N5O6 — CID 22811848
(2S)-N-[(2S)-6-amino-1-(4-nitroanilino)-1-oxohexan-2-yl]-N-(2-phenoxyacetyl)pyrrolidine-2-carboxamide (PubChem CID 22811848) has the molecular formula C25H31N5O6 and a molecular weight of 497.55 g/mol. Its IUPAC name is (2S)-N-[(2S)-6-amino-1-(4-nitroanilino)-1-oxohexan-2-yl]-N-(2-phenoxyacetyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(2S)-6-amino-1-(4-nitroanilino)-1-oxohexan-2-yl]-N-(2-phenoxyacetyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 22811848 |
| Molecular Formula | C25H31N5O6 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | (2S)-N-[(2S)-6-amino-1-(4-nitroanilino)-1-oxohexan-2-yl]-N-(2-phenoxyacetyl)pyrrolidine-2-carboxamide |
| SMILES | NCCCC[C@@H](C(=O)Nc1ccc([N+](=O)[O-])cc1)N(C(=O)COc1ccccc1)C(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C25H31N5O6/c26-15-5-4-10-22(24(32)28-18-11-13-19(14-12-18)30(34)35)29(25(33)21-9-6-16-27-21)23(31)17-36-20-7-2-1-3-8-20/h1-3,7-8,11-14,21-22,27H,4-6,9-10,15-17,26H2,(H,28,32)/t21-,22-/m0/s1 |
| InChIKey | QFUFBBKCUVDHFO-VXKWHMMOSA-N |
| XLogP | 2.22 |
| TPSA | 156.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|