C24H38N8O7 — CID 67651678
acetic acid;(2S)-2-[[2-[(2-aminoacetyl)amino]acetyl]-cyclohexylamino]-5-(diaminomethylideneamino)-N-(4-nitrophenyl)pentanamide (PubChem CID 67651678) has the molecular formula C24H38N8O7 and a molecular weight of 550.62 g/mol. Its IUPAC name is acetic acid;(2S)-2-[[2-[(2-aminoacetyl)amino]acetyl]-cyclohexylamino]-5-(diaminomethylideneamino)-N-(4-nitrophenyl)pentanamide.
| Compound Name | acetic acid;(2S)-2-[[2-[(2-aminoacetyl)amino]acetyl]-cyclohexylamino]-5-(diaminomethylideneamino)-N-(4-nitrophenyl)pentanamide |
|---|---|
| PubChem CID | 67651678 |
| Molecular Formula | C24H38N8O7 |
| Molecular Weight | 550.62 g/mol |
| Exact Mass | 550.29 |
| IUPAC Name | acetic acid;(2S)-2-[[2-[(2-aminoacetyl)amino]acetyl]-cyclohexylamino]-5-(diaminomethylideneamino)-N-(4-nitrophenyl)pentanamide |
| SMILES | CC(=O)O.NCC(=O)NCC(=O)N(C1CCCCC1)[C@@H](CCCN=C(N)N)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H34N8O5.C2H4O2/c23-13-19(31)27-14-20(32)29(16-5-2-1-3-6-16)18(7-4-12-26-22(24)25)21(33)28-15-8-10-17(11-9-15)30(34)35;1-2(3)4/h8-11,16,18H,1-7,12-14,23H2,(H,27,31)(H,28,33)(H4,24,25,26);1H3,(H,3,4)/t18-;/m0./s1 |
| InChIKey | ZEXCRDSFCUWASL-FERBBOLQSA-N |
| XLogP | 0.28 |
| TPSA | 249.37 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.62 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|