C14H23Cl2N7O4 — CID 127263107
(2S)-2-(N-(2-aminoacetyl)-4-nitroanilino)-5-(diaminomethylideneamino)pentanamide;dihydrochloride (PubChem CID 127263107) has the molecular formula C14H23Cl2N7O4 and a molecular weight of 424.29 g/mol. Its IUPAC name is (2S)-2-(N-(2-aminoacetyl)-4-nitroanilino)-5-(diaminomethylideneamino)pentanamide;dihydrochloride.
| Compound Name | (2S)-2-(N-(2-aminoacetyl)-4-nitroanilino)-5-(diaminomethylideneamino)pentanamide;dihydrochloride |
|---|---|
| PubChem CID | 127263107 |
| Molecular Formula | C14H23Cl2N7O4 |
| Molecular Weight | 424.29 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | (2S)-2-(N-(2-aminoacetyl)-4-nitroanilino)-5-(diaminomethylideneamino)pentanamide;dihydrochloride |
| SMILES | Cl.Cl.NCC(=O)N(c1ccc([N+](=O)[O-])cc1)[C@@H](CCCN=C(N)N)C(N)=O |
| InChI | InChI=1S/C14H21N7O4.2ClH/c15-8-12(22)20(9-3-5-10(6-4-9)21(24)25)11(13(16)23)2-1-7-19-14(17)18;;/h3-6,11H,1-2,7-8,15H2,(H2,16,23)(H4,17,18,19);2*1H/t11-;;/m0../s1 |
| InChIKey | NPRWTUZPZJGPGU-IDMXKUIJSA-N |
| XLogP | -0.36 |
| TPSA | 196.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.29 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|