C21H32N6O5 — CID 22812223
(2S)-N-(4-aminobutanoyl)-N-[(2S)-6-amino-1-(4-nitroanilino)-1-oxohexan-2-yl]pyrrolidine-2-carboxamide (PubChem CID 22812223) has the molecular formula C21H32N6O5 and a molecular weight of 448.52 g/mol. Its IUPAC name is (2S)-N-(4-aminobutanoyl)-N-[(2S)-6-amino-1-(4-nitroanilino)-1-oxohexan-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-(4-aminobutanoyl)-N-[(2S)-6-amino-1-(4-nitroanilino)-1-oxohexan-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 22812223 |
| Molecular Formula | C21H32N6O5 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | (2S)-N-(4-aminobutanoyl)-N-[(2S)-6-amino-1-(4-nitroanilino)-1-oxohexan-2-yl]pyrrolidine-2-carboxamide |
| SMILES | NCCCC[C@@H](C(=O)Nc1ccc([N+](=O)[O-])cc1)N(C(=O)CCCN)C(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C21H32N6O5/c22-12-2-1-6-18(20(29)25-15-8-10-16(11-9-15)27(31)32)26(19(28)7-3-13-23)21(30)17-5-4-14-24-17/h8-11,17-18,24H,1-7,12-14,22-23H2,(H,25,29)/t17-,18-/m0/s1 |
| InChIKey | KNKRIWLKFIFSPJ-ROUUACIJSA-N |
| XLogP | 0.88 |
| TPSA | 173.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|