C21H24N4O7 — CID 161304880
(2S)-N-(4-nitrophenyl)pyrrolidine-2-carboxamide;2-(phenylmethoxycarbonylamino)acetic acid (PubChem CID 161304880) has the molecular formula C21H24N4O7 and a molecular weight of 444.44 g/mol. Its IUPAC name is (2S)-N-(4-nitrophenyl)pyrrolidine-2-carboxamide;2-(phenylmethoxycarbonylamino)acetic acid.
| Compound Name | (2S)-N-(4-nitrophenyl)pyrrolidine-2-carboxamide;2-(phenylmethoxycarbonylamino)acetic acid |
|---|---|
| PubChem CID | 161304880 |
| Molecular Formula | C21H24N4O7 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | (2S)-N-(4-nitrophenyl)pyrrolidine-2-carboxamide;2-(phenylmethoxycarbonylamino)acetic acid |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)[C@@H]1CCCN1.O=C(O)CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C11H13N3O3.C10H11NO4/c15-11(10-2-1-7-12-10)13-8-3-5-9(6-4-8)14(16)17;12-9(13)6-11-10(14)15-7-8-4-2-1-3-5-8/h3-6,10,12H,1-2,7H2,(H,13,15);1-5H,6-7H2,(H,11,14)(H,12,13)/t10-;/m0./s1 |
| InChIKey | VICOIDBHGVJOPN-PPHPATTJSA-N |
| XLogP | 2.28 |
| TPSA | 159.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|