C16H19ClN2O4 — CID 57024973
benzyl N-[3-chloro-2,4-dioxo-4-[(2R)-pyrrolidin-2-yl]butyl]carbamate (PubChem CID 57024973) has the molecular formula C16H19ClN2O4 and a molecular weight of 338.79 g/mol. Its IUPAC name is benzyl N-[3-chloro-2,4-dioxo-4-[(2R)-pyrrolidin-2-yl]butyl]carbamate.
| Compound Name | benzyl N-[3-chloro-2,4-dioxo-4-[(2R)-pyrrolidin-2-yl]butyl]carbamate |
|---|---|
| PubChem CID | 57024973 |
| Molecular Formula | C16H19ClN2O4 |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | benzyl N-[3-chloro-2,4-dioxo-4-[(2R)-pyrrolidin-2-yl]butyl]carbamate |
| SMILES | O=C(NCC(=O)C(Cl)C(=O)[C@H]1CCCN1)OCc1ccccc1 |
| InChI | InChI=1S/C16H19ClN2O4/c17-14(15(21)12-7-4-8-18-12)13(20)9-19-16(22)23-10-11-5-2-1-3-6-11/h1-3,5-6,12,14,18H,4,7-10H2,(H,19,22)/t12-,14?/m1/s1 |
| InChIKey | LHXOAJGNTNGPPJ-PUODRLBUSA-N |
| XLogP | 1.41 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|