C23H28N4O5 — CID 56670275
benzyl N-[(4S)-5-(hydroxyamino)-5-oxo-4-[[(3S)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]amino]pentyl]carbamate (PubChem CID 56670275) has the molecular formula C23H28N4O5 and a molecular weight of 440.50 g/mol. Its IUPAC name is benzyl N-[(4S)-5-(hydroxyamino)-5-oxo-4-[[(3S)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]amino]pentyl]carbamate.
| Compound Name | benzyl N-[(4S)-5-(hydroxyamino)-5-oxo-4-[[(3S)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]amino]pentyl]carbamate |
|---|---|
| PubChem CID | 56670275 |
| Molecular Formula | C23H28N4O5 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | benzyl N-[(4S)-5-(hydroxyamino)-5-oxo-4-[[(3S)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]amino]pentyl]carbamate |
| SMILES | O=C(NCCC[C@H](NC(=O)[C@@H]1Cc2ccccc2CN1)C(=O)NO)OCc1ccccc1 |
| InChI | InChI=1S/C23H28N4O5/c28-21(20-13-17-9-4-5-10-18(17)14-25-20)26-19(22(29)27-31)11-6-12-24-23(30)32-15-16-7-2-1-3-8-16/h1-5,7-10,19-20,25,31H,6,11-15H2,(H,24,30)(H,26,28)(H,27,29)/t19-,20-/m0/s1 |
| InChIKey | DCKXNBKEAXDNLR-PMACEKPBSA-N |
| XLogP | 1.40 |
| TPSA | 128.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|