C20H35N3O5 — CID 15927647
(2S)-1-[(2S)-2-[[(1S)-1-carboxy-6-piperidin-4-ylhexyl]amino]propanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 15927647) has the molecular formula C20H35N3O5 and a molecular weight of 397.52 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-[[(1S)-1-carboxy-6-piperidin-4-ylhexyl]amino]propanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(2S)-2-[[(1S)-1-carboxy-6-piperidin-4-ylhexyl]amino]propanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 15927647 |
| Molecular Formula | C20H35N3O5 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | (2S)-1-[(2S)-2-[[(1S)-1-carboxy-6-piperidin-4-ylhexyl]amino]propanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | C[C@H](N[C@@H](CCCCCC1CCNCC1)C(=O)O)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C20H35N3O5/c1-14(18(24)23-13-5-8-17(23)20(27)28)22-16(19(25)26)7-4-2-3-6-15-9-11-21-12-10-15/h14-17,21-22H,2-13H2,1H3,(H,25,26)(H,27,28)/t14-,16-,17-/m0/s1 |
| InChIKey | ZABJPLSSQBVCJB-XIRDDKMYSA-N |
| XLogP | 1.44 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|