C24H41N3O5 — CID 15927659
1-[2-[(1-carboxy-6-piperidin-4-ylhexyl)amino]propanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 15927659) has the molecular formula C24H41N3O5 and a molecular weight of 451.61 g/mol. Its IUPAC name is 1-[2-[(1-carboxy-6-piperidin-4-ylhexyl)amino]propanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | 1-[2-[(1-carboxy-6-piperidin-4-ylhexyl)amino]propanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 15927659 |
| Molecular Formula | C24H41N3O5 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.30 |
| IUPAC Name | 1-[2-[(1-carboxy-6-piperidin-4-ylhexyl)amino]propanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | CC(NC(CCCCCC1CCNCC1)C(=O)O)C(=O)N1C(C(=O)O)CC2CCCCC21 |
| InChI | InChI=1S/C24H41N3O5/c1-16(22(28)27-20-10-6-5-8-18(20)15-21(27)24(31)32)26-19(23(29)30)9-4-2-3-7-17-11-13-25-14-12-17/h16-21,25-26H,2-15H2,1H3,(H,29,30)(H,31,32) |
| InChIKey | PVGCDXKBKJBJDQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|