C20H35N3O5 — CID 13326448
(2S)-1-[(2S)-2-[[(2S)-6-amino-1-ethoxy-1-oxohexan-2-yl]amino]propanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 13326448) has the molecular formula C20H35N3O5 and a molecular weight of 397.52 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-[[(2S)-6-amino-1-ethoxy-1-oxohexan-2-yl]amino]propanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | (2S)-1-[(2S)-2-[[(2S)-6-amino-1-ethoxy-1-oxohexan-2-yl]amino]propanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 13326448 |
| Molecular Formula | C20H35N3O5 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | (2S)-1-[(2S)-2-[[(2S)-6-amino-1-ethoxy-1-oxohexan-2-yl]amino]propanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | CCOC(=O)[C@H](CCCCN)N[C@@H](C)C(=O)N1C2CCCCC2C[C@H]1C(=O)O |
| InChI | InChI=1S/C20H35N3O5/c1-3-28-20(27)15(9-6-7-11-21)22-13(2)18(24)23-16-10-5-4-8-14(16)12-17(23)19(25)26/h13-17,22H,3-12,21H2,1-2H3,(H,25,26)/t13-,14?,15-,16?,17-/m0/s1 |
| InChIKey | QVDXOGBHIGEABJ-OQBQERNKSA-N |
| XLogP | 1.27 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|