C23H36N2O9 — CID 174650662
(2S,3aS,7aS)-1-[2-[(1-ethoxy-1-oxopentan-2-yl)amino]propanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid;(Z)-but-2-enedioic acid (PubChem CID 174650662) has the molecular formula C23H36N2O9 and a molecular weight of 484.55 g/mol. Its IUPAC name is (2S,3aS,7aS)-1-[2-[(1-ethoxy-1-oxopentan-2-yl)amino]propanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid;(Z)-but-2-enedioic acid.
| Compound Name | (2S,3aS,7aS)-1-[2-[(1-ethoxy-1-oxopentan-2-yl)amino]propanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 174650662 |
| Molecular Formula | C23H36N2O9 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | (2S,3aS,7aS)-1-[2-[(1-ethoxy-1-oxopentan-2-yl)amino]propanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid;(Z)-but-2-enedioic acid |
| SMILES | CCCC(NC(C)C(=O)N1[C@H](C(=O)O)C[C@@H]2CCCC[C@@H]21)C(=O)OCC.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C19H32N2O5.C4H4O4/c1-4-8-14(19(25)26-5-2)20-12(3)17(22)21-15-10-7-6-9-13(15)11-16(21)18(23)24;5-3(6)1-2-4(7)8/h12-16,20H,4-11H2,1-3H3,(H,23,24);1-2H,(H,5,6)(H,7,8)/b;2-1-/t12?,13-,14?,15-,16-;/m0./s1 |
| InChIKey | VVBVWWJRDLBLNG-VTCLZPOFSA-N |
| XLogP | 1.65 |
| TPSA | 170.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|