C20H32N2O5 — CID 70468993
(2S)-1-[(2S)-2-[(3-cyclopropyl-1-ethoxy-1-oxopropan-2-yl)amino]propanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 70468993) has the molecular formula C20H32N2O5 and a molecular weight of 380.49 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-[(3-cyclopropyl-1-ethoxy-1-oxopropan-2-yl)amino]propanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | (2S)-1-[(2S)-2-[(3-cyclopropyl-1-ethoxy-1-oxopropan-2-yl)amino]propanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 70468993 |
| Molecular Formula | C20H32N2O5 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | (2S)-1-[(2S)-2-[(3-cyclopropyl-1-ethoxy-1-oxopropan-2-yl)amino]propanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | CCOC(=O)C(CC1CC1)N[C@@H](C)C(=O)N1C2CCCCC2C[C@H]1C(=O)O |
| InChI | InChI=1S/C20H32N2O5/c1-3-27-20(26)15(10-13-8-9-13)21-12(2)18(23)22-16-7-5-4-6-14(16)11-17(22)19(24)25/h12-17,21H,3-11H2,1-2H3,(H,24,25)/t12-,14?,15?,16?,17-/m0/s1 |
| InChIKey | UUOYJXBHIFHDCK-MMRXQZHGSA-N |
| XLogP | 1.94 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |