C23H43N3O5 — CID 174596026
(2S,3aS,7aS)-1-[2-[(1-ethoxy-1-oxopentan-2-yl)amino]propanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid;butan-2-amine (PubChem CID 174596026) has the molecular formula C23H43N3O5 and a molecular weight of 441.61 g/mol. Its IUPAC name is (2S,3aS,7aS)-1-[2-[(1-ethoxy-1-oxopentan-2-yl)amino]propanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid;butan-2-amine.
| Compound Name | (2S,3aS,7aS)-1-[2-[(1-ethoxy-1-oxopentan-2-yl)amino]propanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid;butan-2-amine |
|---|---|
| PubChem CID | 174596026 |
| Molecular Formula | C23H43N3O5 |
| Molecular Weight | 441.61 g/mol |
| Exact Mass | 441.32 |
| IUPAC Name | (2S,3aS,7aS)-1-[2-[(1-ethoxy-1-oxopentan-2-yl)amino]propanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid;butan-2-amine |
| SMILES | CCC(C)N.CCCC(NC(C)C(=O)N1[C@H](C(=O)O)C[C@@H]2CCCC[C@@H]21)C(=O)OCC |
| InChI | InChI=1S/C19H32N2O5.C4H11N/c1-4-8-14(19(25)26-5-2)20-12(3)17(22)21-15-10-7-6-9-13(15)11-16(21)18(23)24;1-3-4(2)5/h12-16,20H,4-11H2,1-3H3,(H,23,24);4H,3,5H2,1-2H3/t12?,13-,14?,15-,16-;/m0./s1 |
| InChIKey | DPIOYJPKUAQQLV-KTDSKKHRSA-N |
| XLogP | 2.68 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.61 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |