C34H42F17N3O8 — CID 87786484
benzyl N-[(2S)-1-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecylamino)-6-[[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]acetyl]amino]-1-oxohexan-2-yl]carbamate (PubChem CID 87786484) has the molecular formula C34H42F17N3O8 and a molecular weight of 943.69 g/mol. Its IUPAC name is benzyl N-[(2S)-1-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecylamino)-6-[[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]acetyl]amino]-1-oxohexan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecylamino)-6-[[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]acetyl]amino]-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 87786484 |
| Molecular Formula | C34H42F17N3O8 |
| Molecular Weight | 943.69 g/mol |
| Exact Mass | 943.27 |
| IUPAC Name | benzyl N-[(2S)-1-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecylamino)-6-[[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]acetyl]amino]-1-oxohexan-2-yl]carbamate |
| SMILES | COCCOCCOCCOCC(=O)NCCCC[C@H](NC(=O)OCc1ccccc1)C(=O)NCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C34H42F17N3O8/c1-58-14-15-59-16-17-60-18-19-61-21-24(55)52-12-6-5-10-23(54-26(57)62-20-22-8-3-2-4-9-22)25(56)53-13-7-11-27(35,36)28(37,38)29(39,40)30(41,42)31(43,44)32(45,46)33(47,48)34(49,50)51/h2-4,8-9,23H,5-7,10-21H2,1H3,(H,52,55)(H,53,56)(H,54,57)/t23-/m0/s1 |
| InChIKey | XDTBBPGBTRRDIA-QHCPKHFHSA-N |
| XLogP | 7.17 |
| TPSA | 133.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.69 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|