C27H26F21N3O3 — CID 87757591
benzyl N-[(5S)-5-amino-6-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluorotridecylamino)-6-oxohexyl]carbamate (PubChem CID 87757591) has the molecular formula C27H26F21N3O3 and a molecular weight of 839.48 g/mol. Its IUPAC name is benzyl N-[(5S)-5-amino-6-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluorotridecylamino)-6-oxohexyl]carbamate.
| Compound Name | benzyl N-[(5S)-5-amino-6-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluorotridecylamino)-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 87757591 |
| Molecular Formula | C27H26F21N3O3 |
| Molecular Weight | 839.48 g/mol |
| Exact Mass | 839.16 |
| IUPAC Name | benzyl N-[(5S)-5-amino-6-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluorotridecylamino)-6-oxohexyl]carbamate |
| SMILES | N[C@@H](CCCCNC(=O)OCc1ccccc1)C(=O)NCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C27H26F21N3O3/c28-18(29,10-6-12-50-16(52)15(49)9-4-5-11-51-17(53)54-13-14-7-2-1-3-8-14)19(30,31)20(32,33)21(34,35)22(36,37)23(38,39)24(40,41)25(42,43)26(44,45)27(46,47)48/h1-3,7-8,15H,4-6,9-13,49H2,(H,50,52)(H,51,53)/t15-/m0/s1 |
| InChIKey | ODSOFKBOKPVKPQ-HNNXBMFYSA-N |
| XLogP | 8.59 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.48 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|