C39H58N4O8 — CID 129081877
[[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 4-[[(2S)-6-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]butanoate (PubChem CID 129081877) has the molecular formula C39H58N4O8 and a molecular weight of 710.91 g/mol. Its IUPAC name is [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 4-[[(2S)-6-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]butanoate.
| Compound Name | [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 4-[[(2S)-6-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]butanoate |
|---|---|
| PubChem CID | 129081877 |
| Molecular Formula | C39H58N4O8 |
| Molecular Weight | 710.91 g/mol |
| Exact Mass | 710.43 |
| IUPAC Name | [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 4-[[(2S)-6-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]butanoate |
| SMILES | CN(CCCC[C@H](NC(=O)OC(C)(C)C)C(=O)NCCCC(=O)ONC(=O)Cc1ccc(CCCCc2ccccc2)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C39H58N4O8/c1-38(2,3)49-36(47)41-32(20-13-14-27-43(7)37(48)50-39(4,5)6)35(46)40-26-15-21-34(45)51-42-33(44)28-31-24-22-30(23-25-31)19-12-11-18-29-16-9-8-10-17-29/h8-10,16-17,22-25,32H,11-15,18-21,26-28H2,1-7H3,(H,40,46)(H,41,47)(H,42,44)/t32-/m0/s1 |
| InChIKey | AZMYUVILQHRGDF-YTTGMZPUSA-N |
| XLogP | 6.20 |
| TPSA | 152.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.91 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|