C25H36BN3O5 — CID 153277629
[(1R)-1-[[(2S)-1-(2-cyano-4,4-dimethylpent-2-enoyl)azepan-2-yl]methoxycarbonylamino]-2-(4-methylphenyl)ethyl]boronic acid (PubChem CID 153277629) has the molecular formula C25H36BN3O5 and a molecular weight of 469.39 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-1-(2-cyano-4,4-dimethylpent-2-enoyl)azepan-2-yl]methoxycarbonylamino]-2-(4-methylphenyl)ethyl]boronic acid.
| Compound Name | [(1R)-1-[[(2S)-1-(2-cyano-4,4-dimethylpent-2-enoyl)azepan-2-yl]methoxycarbonylamino]-2-(4-methylphenyl)ethyl]boronic acid |
|---|---|
| PubChem CID | 153277629 |
| Molecular Formula | C25H36BN3O5 |
| Molecular Weight | 469.39 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | [(1R)-1-[[(2S)-1-(2-cyano-4,4-dimethylpent-2-enoyl)azepan-2-yl]methoxycarbonylamino]-2-(4-methylphenyl)ethyl]boronic acid |
| SMILES | Cc1ccc(C[C@H](NC(=O)OC[C@@H]2CCCCCN2C(=O)C(C#N)=CC(C)(C)C)B(O)O)cc1 |
| InChI | InChI=1S/C25H36BN3O5/c1-18-9-11-19(12-10-18)14-22(26(32)33)28-24(31)34-17-21-8-6-5-7-13-29(21)23(30)20(16-27)15-25(2,3)4/h9-12,15,21-22,32-33H,5-8,13-14,17H2,1-4H3,(H,28,31)/t21-,22-/m0/s1 |
| InChIKey | XSZSYPBHEPGSRH-VXKWHMMOSA-N |
| XLogP | 2.91 |
| TPSA | 122.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|