C26H36BFN4O5 — CID 175396731
[(2R)-2-[[(2R)-1-[2-cyano-4-[(3R)-3-fluoropyrrolidin-1-yl]-4-methylpent-2-enoyl]piperidin-2-yl]methoxycarbonylamino]-2-phenylethyl]boronic acid (PubChem CID 175396731) has the molecular formula C26H36BFN4O5 and a molecular weight of 514.41 g/mol. Its IUPAC name is [(2R)-2-[[(2R)-1-[2-cyano-4-[(3R)-3-fluoropyrrolidin-1-yl]-4-methylpent-2-enoyl]piperidin-2-yl]methoxycarbonylamino]-2-phenylethyl]boronic acid.
| Compound Name | [(2R)-2-[[(2R)-1-[2-cyano-4-[(3R)-3-fluoropyrrolidin-1-yl]-4-methylpent-2-enoyl]piperidin-2-yl]methoxycarbonylamino]-2-phenylethyl]boronic acid |
|---|---|
| PubChem CID | 175396731 |
| Molecular Formula | C26H36BFN4O5 |
| Molecular Weight | 514.41 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | [(2R)-2-[[(2R)-1-[2-cyano-4-[(3R)-3-fluoropyrrolidin-1-yl]-4-methylpent-2-enoyl]piperidin-2-yl]methoxycarbonylamino]-2-phenylethyl]boronic acid |
| SMILES | CC(C)(C=C(C#N)C(=O)N1CCCC[C@@H]1COC(=O)N[C@H](CB(O)O)c1ccccc1)N1CC[C@@H](F)C1 |
| InChI | InChI=1S/C26H36BFN4O5/c1-26(2,31-13-11-21(28)17-31)14-20(16-29)24(33)32-12-7-6-10-22(32)18-37-25(34)30-23(15-27(35)36)19-8-4-3-5-9-19/h3-5,8-9,14,21-23,35-36H,6-7,10-13,15,17-18H2,1-2H3,(H,30,34)/t21-,22-,23-/m1/s1 |
| InChIKey | XJHWYSSFEGGGCE-DNVJHFABSA-N |
| XLogP | 2.58 |
| TPSA | 126.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|