C17H27N3O3 — CID 151984465
2-[(2R)-2-(hydroxymethyl)piperidine-1-carbonyl]-4-methyl-4-morpholin-4-ylpent-2-enenitrile (PubChem CID 151984465) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is 2-[(2R)-2-(hydroxymethyl)piperidine-1-carbonyl]-4-methyl-4-morpholin-4-ylpent-2-enenitrile.
| Compound Name | 2-[(2R)-2-(hydroxymethyl)piperidine-1-carbonyl]-4-methyl-4-morpholin-4-ylpent-2-enenitrile |
|---|---|
| PubChem CID | 151984465 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 2-[(2R)-2-(hydroxymethyl)piperidine-1-carbonyl]-4-methyl-4-morpholin-4-ylpent-2-enenitrile |
| SMILES | CC(C)(C=C(C#N)C(=O)N1CCCC[C@@H]1CO)N1CCOCC1 |
| InChI | InChI=1S/C17H27N3O3/c1-17(2,19-7-9-23-10-8-19)11-14(12-18)16(22)20-6-4-3-5-15(20)13-21/h11,15,21H,3-10,13H2,1-2H3/t15-/m1/s1 |
| InChIKey | UDJGZYLOWDMGPV-OAHLLOKOSA-N |
| XLogP | 0.92 |
| TPSA | 76.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|