C17H23BN4O4 — CID 174000630
[(1R)-1-[[(3S)-1-(2-cyanopropanoyl)pyrrolidin-3-yl]carbamoylamino]-2-phenylethyl]boronic acid (PubChem CID 174000630) has the molecular formula C17H23BN4O4 and a molecular weight of 358.21 g/mol. Its IUPAC name is [(1R)-1-[[(3S)-1-(2-cyanopropanoyl)pyrrolidin-3-yl]carbamoylamino]-2-phenylethyl]boronic acid.
| Compound Name | [(1R)-1-[[(3S)-1-(2-cyanopropanoyl)pyrrolidin-3-yl]carbamoylamino]-2-phenylethyl]boronic acid |
|---|---|
| PubChem CID | 174000630 |
| Molecular Formula | C17H23BN4O4 |
| Molecular Weight | 358.21 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | [(1R)-1-[[(3S)-1-(2-cyanopropanoyl)pyrrolidin-3-yl]carbamoylamino]-2-phenylethyl]boronic acid |
| SMILES | CC(C#N)C(=O)N1CC[C@H](NC(=O)N[C@@H](Cc2ccccc2)B(O)O)C1 |
| InChI | InChI=1S/C17H23BN4O4/c1-12(10-19)16(23)22-8-7-14(11-22)20-17(24)21-15(18(25)26)9-13-5-3-2-4-6-13/h2-6,12,14-15,25-26H,7-9,11H2,1H3,(H2,20,21,24)/t12?,14-,15-/m0/s1 |
| InChIKey | NYBVXBMDFLSLQB-ZRNAQANOSA-N |
| XLogP | -0.33 |
| TPSA | 125.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.21 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|