C24H31BN4O5 — CID 155607181
[(1R)-2-(1-benzofuran-3-yl)-1-[[(2R)-1-(2-isocyano-4,4-dimethylpent-2-enoyl)pyrrolidin-2-yl]methylcarbamoylamino]ethyl]boronic acid (PubChem CID 155607181) has the molecular formula C24H31BN4O5 and a molecular weight of 466.35 g/mol. Its IUPAC name is [(1R)-2-(1-benzofuran-3-yl)-1-[[(2R)-1-(2-isocyano-4,4-dimethylpent-2-enoyl)pyrrolidin-2-yl]methylcarbamoylamino]ethyl]boronic acid.
| Compound Name | [(1R)-2-(1-benzofuran-3-yl)-1-[[(2R)-1-(2-isocyano-4,4-dimethylpent-2-enoyl)pyrrolidin-2-yl]methylcarbamoylamino]ethyl]boronic acid |
|---|---|
| PubChem CID | 155607181 |
| Molecular Formula | C24H31BN4O5 |
| Molecular Weight | 466.35 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | [(1R)-2-(1-benzofuran-3-yl)-1-[[(2R)-1-(2-isocyano-4,4-dimethylpent-2-enoyl)pyrrolidin-2-yl]methylcarbamoylamino]ethyl]boronic acid |
| SMILES | [C-]#[N+]C(=CC(C)(C)C)C(=O)N1CCC[C@@H]1CNC(=O)N[C@@H](Cc1coc2ccccc12)B(O)O |
| InChI | InChI=1S/C24H31BN4O5/c1-24(2,3)13-19(26-4)22(30)29-11-7-8-17(29)14-27-23(31)28-21(25(32)33)12-16-15-34-20-10-6-5-9-18(16)20/h5-6,9-10,13,15,17,21,32-33H,7-8,11-12,14H2,1-3H3,(H2,27,28,31)/t17-,21+/m1/s1 |
| InChIKey | RLZIJNDPJBKSGH-UTKZUKDTSA-N |
| XLogP | 2.50 |
| TPSA | 119.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|