C17H24BN3O4 — CID 142596603
[(1R)-2-phenyl-1-[[(2R)-1-prop-2-enoylpyrrolidin-2-yl]methylcarbamoylamino]ethyl]boronic acid (PubChem CID 142596603) has the molecular formula C17H24BN3O4 and a molecular weight of 345.21 g/mol. Its IUPAC name is [(1R)-2-phenyl-1-[[(2R)-1-prop-2-enoylpyrrolidin-2-yl]methylcarbamoylamino]ethyl]boronic acid.
| Compound Name | [(1R)-2-phenyl-1-[[(2R)-1-prop-2-enoylpyrrolidin-2-yl]methylcarbamoylamino]ethyl]boronic acid |
|---|---|
| PubChem CID | 142596603 |
| Molecular Formula | C17H24BN3O4 |
| Molecular Weight | 345.21 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | [(1R)-2-phenyl-1-[[(2R)-1-prop-2-enoylpyrrolidin-2-yl]methylcarbamoylamino]ethyl]boronic acid |
| SMILES | C=CC(=O)N1CCC[C@@H]1CNC(=O)N[C@@H](Cc1ccccc1)B(O)O |
| InChI | InChI=1S/C17H24BN3O4/c1-2-16(22)21-10-6-9-14(21)12-19-17(23)20-15(18(24)25)11-13-7-4-3-5-8-13/h2-5,7-8,14-15,24-25H,1,6,9-12H2,(H2,19,20,23)/t14-,15+/m1/s1 |
| InChIKey | JSVIWKIDKVCLTF-CABCVRRESA-N |
| XLogP | 0.09 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.21 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|