C18H25BN2O5 — CID 174151121
[(1R)-3-phenyl-1-[[(3S)-1-prop-2-enoylpiperidin-3-yl]oxycarbonylamino]propyl]boronic acid (PubChem CID 174151121) has the molecular formula C18H25BN2O5 and a molecular weight of 360.22 g/mol. Its IUPAC name is [(1R)-3-phenyl-1-[[(3S)-1-prop-2-enoylpiperidin-3-yl]oxycarbonylamino]propyl]boronic acid.
| Compound Name | [(1R)-3-phenyl-1-[[(3S)-1-prop-2-enoylpiperidin-3-yl]oxycarbonylamino]propyl]boronic acid |
|---|---|
| PubChem CID | 174151121 |
| Molecular Formula | C18H25BN2O5 |
| Molecular Weight | 360.22 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | [(1R)-3-phenyl-1-[[(3S)-1-prop-2-enoylpiperidin-3-yl]oxycarbonylamino]propyl]boronic acid |
| SMILES | C=CC(=O)N1CCC[C@H](OC(=O)N[C@@H](CCc2ccccc2)B(O)O)C1 |
| InChI | InChI=1S/C18H25BN2O5/c1-2-17(22)21-12-6-9-15(13-21)26-18(23)20-16(19(24)25)11-10-14-7-4-3-5-8-14/h2-5,7-8,15-16,24-25H,1,6,9-13H2,(H,20,23)/t15-,16-/m0/s1 |
| InChIKey | ISKCWLSVPKELJJ-HOTGVXAUSA-N |
| XLogP | 0.90 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.22 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|