C17H22BFN2O6 — CID 155759436
[(1R)-2-(4-fluorophenyl)-1-[[(3S)-1-prop-2-enoylpiperidin-3-yl]oxycarbonylamino]ethoxy]boronic acid (PubChem CID 155759436) has the molecular formula C17H22BFN2O6 and a molecular weight of 380.18 g/mol. Its IUPAC name is [(1R)-2-(4-fluorophenyl)-1-[[(3S)-1-prop-2-enoylpiperidin-3-yl]oxycarbonylamino]ethoxy]boronic acid.
| Compound Name | [(1R)-2-(4-fluorophenyl)-1-[[(3S)-1-prop-2-enoylpiperidin-3-yl]oxycarbonylamino]ethoxy]boronic acid |
|---|---|
| PubChem CID | 155759436 |
| Molecular Formula | C17H22BFN2O6 |
| Molecular Weight | 380.18 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | [(1R)-2-(4-fluorophenyl)-1-[[(3S)-1-prop-2-enoylpiperidin-3-yl]oxycarbonylamino]ethoxy]boronic acid |
| SMILES | C=CC(=O)N1CCC[C@H](OC(=O)N[C@@H](Cc2ccc(F)cc2)OB(O)O)C1 |
| InChI | InChI=1S/C17H22BFN2O6/c1-2-16(22)21-9-3-4-14(11-21)26-17(23)20-15(27-18(24)25)10-12-5-7-13(19)8-6-12/h2,5-8,14-15,24-25H,1,3-4,9-11H2,(H,20,23)/t14-,15+/m0/s1 |
| InChIKey | HZDLINSDXDICTB-LSDHHAIUSA-N |
| XLogP | 0.58 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.18 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|