C15H17ClN4O2 — CID 142615177
1-[3-[(5-chloro-2-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)oxy]piperidin-1-yl]prop-2-en-1-one (PubChem CID 142615177) has the molecular formula C15H17ClN4O2 and a molecular weight of 320.78 g/mol. Its IUPAC name is 1-[3-[(5-chloro-2-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)oxy]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[(5-chloro-2-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)oxy]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 142615177 |
| Molecular Formula | C15H17ClN4O2 |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 1-[3-[(5-chloro-2-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)oxy]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC(Oc2nc(C)nc3[nH]cc(Cl)c23)C1 |
| InChI | InChI=1S/C15H17ClN4O2/c1-3-12(21)20-6-4-5-10(8-20)22-15-13-11(16)7-17-14(13)18-9(2)19-15/h3,7,10H,1,4-6,8H2,2H3,(H,17,18,19) |
| InChIKey | AFZGNNNPOOYWOA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|