C12H21F2NO2 — CID 164539268
1-[3-(1,1-difluoroethoxy)piperidin-1-yl]prop-2-en-1-one;ethane (PubChem CID 164539268) has the molecular formula C12H21F2NO2 and a molecular weight of 249.30 g/mol. Its IUPAC name is 1-[3-(1,1-difluoroethoxy)piperidin-1-yl]prop-2-en-1-one;ethane.
| Compound Name | 1-[3-(1,1-difluoroethoxy)piperidin-1-yl]prop-2-en-1-one;ethane |
|---|---|
| PubChem CID | 164539268 |
| Molecular Formula | C12H21F2NO2 |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 1-[3-(1,1-difluoroethoxy)piperidin-1-yl]prop-2-en-1-one;ethane |
| SMILES | C=CC(=O)N1CCCC(OC(C)(F)F)C1.CC |
| InChI | InChI=1S/C10H15F2NO2.C2H6/c1-3-9(14)13-6-4-5-8(7-13)15-10(2,11)12;1-2/h3,8H,1,4-7H2,2H3;1-2H3 |
| InChIKey | QZBFLMXWIZNHSZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|