C24H24ClN5O3S — CID 155757674
N-(2-chloro-6-methylphenyl)-2-[[6-[(3S)-1-prop-2-enoylpiperidin-3-yl]oxy-2-pyridinyl]amino]-1,3-thiazole-5-carboxamide (PubChem CID 155757674) has the molecular formula C24H24ClN5O3S and a molecular weight of 498.01 g/mol. Its IUPAC name is N-(2-chloro-6-methylphenyl)-2-[[6-[(3S)-1-prop-2-enoylpiperidin-3-yl]oxy-2-pyridinyl]amino]-1,3-thiazole-5-carboxamide.
| Compound Name | N-(2-chloro-6-methylphenyl)-2-[[6-[(3S)-1-prop-2-enoylpiperidin-3-yl]oxy-2-pyridinyl]amino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 155757674 |
| Molecular Formula | C24H24ClN5O3S |
| Molecular Weight | 498.01 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | N-(2-chloro-6-methylphenyl)-2-[[6-[(3S)-1-prop-2-enoylpiperidin-3-yl]oxy-2-pyridinyl]amino]-1,3-thiazole-5-carboxamide |
| SMILES | C=CC(=O)N1CCC[C@H](Oc2cccc(Nc3ncc(C(=O)Nc4c(C)cccc4Cl)s3)n2)C1 |
| InChI | InChI=1S/C24H24ClN5O3S/c1-3-21(31)30-12-6-8-16(14-30)33-20-11-5-10-19(27-20)28-24-26-13-18(34-24)23(32)29-22-15(2)7-4-9-17(22)25/h3-5,7,9-11,13,16H,1,6,8,12,14H2,2H3,(H,29,32)(H,26,27,28)/t16-/m0/s1 |
| InChIKey | WAUVANXDCFUAIN-INIZCTEOSA-N |
| XLogP | 5.05 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.01 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|