C30H26ClF2N7O4S — CID 178002106
N-(2-chloro-6-methylphenyl)-2-[[3-(difluoromethoxy)-6-(12-prop-2-enoyl-8-oxa-1,3,12-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-5-yl)-2-pyridinyl]amino]-1,3-thiazole-5-carboxamide (PubChem CID 178002106) has the molecular formula C30H26ClF2N7O4S and a molecular weight of 654.10 g/mol. Its IUPAC name is N-(2-chloro-6-methylphenyl)-2-[[3-(difluoromethoxy)-6-(12-prop-2-enoyl-8-oxa-1,3,12-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-5-yl)-2-pyridinyl]amino]-1,3-thiazole-5-carboxamide.
| Compound Name | N-(2-chloro-6-methylphenyl)-2-[[3-(difluoromethoxy)-6-(12-prop-2-enoyl-8-oxa-1,3,12-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-5-yl)-2-pyridinyl]amino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 178002106 |
| Molecular Formula | C30H26ClF2N7O4S |
| Molecular Weight | 654.10 g/mol |
| Exact Mass | 653.14 |
| IUPAC Name | N-(2-chloro-6-methylphenyl)-2-[[3-(difluoromethoxy)-6-(12-prop-2-enoyl-8-oxa-1,3,12-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-5-yl)-2-pyridinyl]amino]-1,3-thiazole-5-carboxamide |
| SMILES | C=CC(=O)N1CCN2c3ncc(-c4ccc(OC(F)F)c(Nc5ncc(C(=O)Nc6c(C)cccc6Cl)s5)n4)cc3OCC2C1 |
| InChI | InChI=1S/C30H26ClF2N7O4S/c1-3-24(41)39-9-10-40-18(14-39)15-43-22-11-17(12-34-27(22)40)20-7-8-21(44-29(32)33)26(36-20)38-30-35-13-23(45-30)28(42)37-25-16(2)5-4-6-19(25)31/h3-8,11-13,18,29H,1,9-10,14-15H2,2H3,(H,37,42)(H,35,36,38) |
| InChIKey | BAPXCUGOLOEUTL-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 121.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.10 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|