C32H31F2N7O4S — CID 178002058
N-(2,6-difluorophenyl)-2-[[6-(8,8-dimethyl-13-prop-2-enoyl-9-oxa-1,3,13-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-5-yl)-3-methoxy-2-pyridinyl]amino]-1,3-thiazole-5-carboxamide (PubChem CID 178002058) has the molecular formula C32H31F2N7O4S and a molecular weight of 647.71 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-2-[[6-(8,8-dimethyl-13-prop-2-enoyl-9-oxa-1,3,13-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-5-yl)-3-methoxy-2-pyridinyl]amino]-1,3-thiazole-5-carboxamide.
| Compound Name | N-(2,6-difluorophenyl)-2-[[6-(8,8-dimethyl-13-prop-2-enoyl-9-oxa-1,3,13-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-5-yl)-3-methoxy-2-pyridinyl]amino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 178002058 |
| Molecular Formula | C32H31F2N7O4S |
| Molecular Weight | 647.71 g/mol |
| Exact Mass | 647.21 |
| IUPAC Name | N-(2,6-difluorophenyl)-2-[[6-(8,8-dimethyl-13-prop-2-enoyl-9-oxa-1,3,13-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-5-yl)-3-methoxy-2-pyridinyl]amino]-1,3-thiazole-5-carboxamide |
| SMILES | C=CC(=O)N1CCN2c3ncc(-c4ccc(OC)c(Nc5ncc(C(=O)Nc6c(F)cccc6F)s5)n4)cc3C(C)(C)OCC2C1 |
| InChI | InChI=1S/C32H31F2N7O4S/c1-5-26(42)40-11-12-41-19(16-40)17-45-32(2,3)20-13-18(14-35-29(20)41)23-9-10-24(44-4)28(37-23)39-31-36-15-25(46-31)30(43)38-27-21(33)7-6-8-22(27)34/h5-10,13-15,19H,1,11-12,16-17H2,2-4H3,(H,38,43)(H,36,37,39) |
| InChIKey | SWXFYTKESJZDQN-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 121.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.71 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|