C26H28ClN9O3S — CID 131989217
N-(2-chloro-6-methylphenyl)-2-[[2-[2,2-di(prop-2-enoyl)hydrazinyl]-6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide (PubChem CID 131989217) has the molecular formula C26H28ClN9O3S and a molecular weight of 582.09 g/mol. Its IUPAC name is N-(2-chloro-6-methylphenyl)-2-[[2-[2,2-di(prop-2-enoyl)hydrazinyl]-6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide.
| Compound Name | N-(2-chloro-6-methylphenyl)-2-[[2-[2,2-di(prop-2-enoyl)hydrazinyl]-6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 131989217 |
| Molecular Formula | C26H28ClN9O3S |
| Molecular Weight | 582.09 g/mol |
| Exact Mass | 581.17 |
| IUPAC Name | N-(2-chloro-6-methylphenyl)-2-[[2-[2,2-di(prop-2-enoyl)hydrazinyl]-6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide |
| SMILES | C=CC(=O)N(Nc1nc(Nc2ncc(C(=O)Nc3c(C)cccc3Cl)s2)cc(N2CCN(C)CC2)n1)C(=O)C=C |
| InChI | InChI=1S/C26H28ClN9O3S/c1-5-21(37)36(22(38)6-2)33-25-29-19(14-20(31-25)35-12-10-34(4)11-13-35)30-26-28-15-18(40-26)24(39)32-23-16(3)8-7-9-17(23)27/h5-9,14-15H,1-2,10-13H2,3-4H3,(H,32,39)(H2,28,29,30,31,33) |
| InChIKey | UJSUOBMPJBAFGK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.09 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|