C24H29N7OS — CID 138579122
N-(2,6-dimethylphenyl)-2-[[2-[[(3S)-1-prop-2-enylpiperidin-3-yl]amino]pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide (PubChem CID 138579122) has the molecular formula C24H29N7OS and a molecular weight of 463.61 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[[2-[[(3S)-1-prop-2-enylpiperidin-3-yl]amino]pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[[2-[[(3S)-1-prop-2-enylpiperidin-3-yl]amino]pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 138579122 |
| Molecular Formula | C24H29N7OS |
| Molecular Weight | 463.61 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[[2-[[(3S)-1-prop-2-enylpiperidin-3-yl]amino]pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide |
| SMILES | C=CCN1CCC[C@H](Nc2nccc(Nc3ncc(C(=O)Nc4c(C)cccc4C)s3)n2)C1 |
| InChI | InChI=1S/C24H29N7OS/c1-4-12-31-13-6-9-18(15-31)27-23-25-11-10-20(28-23)29-24-26-14-19(33-24)22(32)30-21-16(2)7-5-8-17(21)3/h4-5,7-8,10-11,14,18H,1,6,9,12-13,15H2,2-3H3,(H,30,32)(H2,25,26,27,28,29)/t18-/m0/s1 |
| InChIKey | JKQPRCNUJYSJSQ-SFHVURJKSA-N |
| XLogP | 4.61 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.61 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|