C17H24BFN2O4 — CID 175584466
[2-(4-fluorophenyl)-1-[(1-prop-1-enylpiperidin-3-yl)oxycarbonylamino]ethyl]boronic acid (PubChem CID 175584466) has the molecular formula C17H24BFN2O4 and a molecular weight of 350.20 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-1-[(1-prop-1-enylpiperidin-3-yl)oxycarbonylamino]ethyl]boronic acid.
| Compound Name | [2-(4-fluorophenyl)-1-[(1-prop-1-enylpiperidin-3-yl)oxycarbonylamino]ethyl]boronic acid |
|---|---|
| PubChem CID | 175584466 |
| Molecular Formula | C17H24BFN2O4 |
| Molecular Weight | 350.20 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | [2-(4-fluorophenyl)-1-[(1-prop-1-enylpiperidin-3-yl)oxycarbonylamino]ethyl]boronic acid |
| SMILES | CC=CN1CCCC(OC(=O)NC(Cc2ccc(F)cc2)B(O)O)C1 |
| InChI | InChI=1S/C17H24BFN2O4/c1-2-9-21-10-3-4-15(12-21)25-17(22)20-16(18(23)24)11-13-5-7-14(19)8-6-13/h2,5-9,15-16,23-24H,3-4,10-12H2,1H3,(H,20,22) |
| InChIKey | HSKWEJAHKJQPDH-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.20 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|