C17H25BN2O4 — CID 175584513
[(1R)-2-phenyl-1-[(1-prop-1-enylpiperidin-3-yl)oxycarbonylamino]ethyl]boronic acid (PubChem CID 175584513) has the molecular formula C17H25BN2O4 and a molecular weight of 332.21 g/mol. Its IUPAC name is [(1R)-2-phenyl-1-[(1-prop-1-enylpiperidin-3-yl)oxycarbonylamino]ethyl]boronic acid.
| Compound Name | [(1R)-2-phenyl-1-[(1-prop-1-enylpiperidin-3-yl)oxycarbonylamino]ethyl]boronic acid |
|---|---|
| PubChem CID | 175584513 |
| Molecular Formula | C17H25BN2O4 |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | [(1R)-2-phenyl-1-[(1-prop-1-enylpiperidin-3-yl)oxycarbonylamino]ethyl]boronic acid |
| SMILES | CC=CN1CCCC(OC(=O)N[C@@H](Cc2ccccc2)B(O)O)C1 |
| InChI | InChI=1S/C17H25BN2O4/c1-2-10-20-11-6-9-15(13-20)24-17(21)19-16(18(22)23)12-14-7-4-3-5-8-14/h2-5,7-8,10,15-16,22-23H,6,9,11-13H2,1H3,(H,19,21)/t15?,16-/m0/s1 |
| InChIKey | AJBGOTJVFQNWHV-LYKKTTPLSA-N |
| XLogP | 1.33 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|