C29H41N3O4 — CID 143935501
tert-butyl piperazine-1-carboxylate;cyclopentyl N-(1,2-diphenylethyl)carbamate (PubChem CID 143935501) has the molecular formula C29H41N3O4 and a molecular weight of 495.66 g/mol. Its IUPAC name is tert-butyl piperazine-1-carboxylate;cyclopentyl N-(1,2-diphenylethyl)carbamate.
| Compound Name | tert-butyl piperazine-1-carboxylate;cyclopentyl N-(1,2-diphenylethyl)carbamate |
|---|---|
| PubChem CID | 143935501 |
| Molecular Formula | C29H41N3O4 |
| Molecular Weight | 495.66 g/mol |
| Exact Mass | 495.31 |
| IUPAC Name | tert-butyl piperazine-1-carboxylate;cyclopentyl N-(1,2-diphenylethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N1CCNCC1.O=C(NC(Cc1ccccc1)c1ccccc1)OC1CCCC1 |
| InChI | InChI=1S/C20H23NO2.C9H18N2O2/c22-20(23-18-13-7-8-14-18)21-19(17-11-5-2-6-12-17)15-16-9-3-1-4-10-16;1-9(2,3)13-8(12)11-6-4-10-5-7-11/h1-6,9-12,18-19H,7-8,13-15H2,(H,21,22);10H,4-7H2,1-3H3 |
| InChIKey | DLMFAJMRYHTZBL-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.66 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |