C29H42N4O3 — CID 143935484
tert-butyl piperazine-1-carboxylate;1-cyclopentyl-3-[(1S)-1,2-diphenylethyl]urea (PubChem CID 143935484) has the molecular formula C29H42N4O3 and a molecular weight of 494.68 g/mol. Its IUPAC name is tert-butyl piperazine-1-carboxylate;1-cyclopentyl-3-[(1S)-1,2-diphenylethyl]urea.
| Compound Name | tert-butyl piperazine-1-carboxylate;1-cyclopentyl-3-[(1S)-1,2-diphenylethyl]urea |
|---|---|
| PubChem CID | 143935484 |
| Molecular Formula | C29H42N4O3 |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.33 |
| IUPAC Name | tert-butyl piperazine-1-carboxylate;1-cyclopentyl-3-[(1S)-1,2-diphenylethyl]urea |
| SMILES | CC(C)(C)OC(=O)N1CCNCC1.O=C(NC1CCCC1)N[C@@H](Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H24N2O.C9H18N2O2/c23-20(21-18-13-7-8-14-18)22-19(17-11-5-2-6-12-17)15-16-9-3-1-4-10-16;1-9(2,3)13-8(12)11-6-4-10-5-7-11/h1-6,9-12,18-19H,7-8,13-15H2,(H2,21,22,23);10H,4-7H2,1-3H3/t19-;/m0./s1 |
| InChIKey | VEMHPGOPSIHPFP-FYZYNONXSA-N |
| XLogP | 5.04 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |