C27H41BN4O6 — CID 174151315
[(1R)-1-[[(3S)-1-(2-cyano-4-methyl-4-morpholin-4-ylpentanoyl)azepan-3-yl]oxycarbonylamino]-3-phenylpropyl]boronic acid (PubChem CID 174151315) has the molecular formula C27H41BN4O6 and a molecular weight of 528.46 g/mol. Its IUPAC name is [(1R)-1-[[(3S)-1-(2-cyano-4-methyl-4-morpholin-4-ylpentanoyl)azepan-3-yl]oxycarbonylamino]-3-phenylpropyl]boronic acid.
| Compound Name | [(1R)-1-[[(3S)-1-(2-cyano-4-methyl-4-morpholin-4-ylpentanoyl)azepan-3-yl]oxycarbonylamino]-3-phenylpropyl]boronic acid |
|---|---|
| PubChem CID | 174151315 |
| Molecular Formula | C27H41BN4O6 |
| Molecular Weight | 528.46 g/mol |
| Exact Mass | 528.31 |
| IUPAC Name | [(1R)-1-[[(3S)-1-(2-cyano-4-methyl-4-morpholin-4-ylpentanoyl)azepan-3-yl]oxycarbonylamino]-3-phenylpropyl]boronic acid |
| SMILES | CC(C)(CC(C#N)C(=O)N1CCCC[C@H](OC(=O)N[C@@H](CCc2ccccc2)B(O)O)C1)N1CCOCC1 |
| InChI | InChI=1S/C27H41BN4O6/c1-27(2,32-14-16-37-17-15-32)18-22(19-29)25(33)31-13-7-6-10-23(20-31)38-26(34)30-24(28(35)36)12-11-21-8-4-3-5-9-21/h3-5,8-9,22-24,35-36H,6-7,10-18,20H2,1-2H3,(H,30,34)/t22?,23-,24-/m0/s1 |
| InChIKey | BJYPUNHRWVZIMH-VYCPFJESSA-N |
| XLogP | 1.75 |
| TPSA | 135.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.46 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|