C18H12ClF3N2O3 — CID 71882429
3-[3-[2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-cyanoethenyl]phenoxy]propanoic acid (PubChem CID 71882429) has the molecular formula C18H12ClF3N2O3 and a molecular weight of 396.75 g/mol. Its IUPAC name is 3-[3-[2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-cyanoethenyl]phenoxy]propanoic acid.
| Compound Name | 3-[3-[2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-cyanoethenyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 71882429 |
| Molecular Formula | C18H12ClF3N2O3 |
| Molecular Weight | 396.75 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | 3-[3-[2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-cyanoethenyl]phenoxy]propanoic acid |
| SMILES | N#CC(=Cc1cccc(OCCC(=O)O)c1)c1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C18H12ClF3N2O3/c19-15-8-13(18(20,21)22)10-24-17(15)12(9-23)6-11-2-1-3-14(7-11)27-5-4-16(25)26/h1-3,6-8,10H,4-5H2,(H,25,26) |
| InChIKey | ACTXRRYFPMPKPM-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 83.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.75 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|