C17H10ClF3N2O3 — CID 75364813
2-[3-[(E)-2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-cyanoethenyl]phenoxy]acetic acid (PubChem CID 75364813) has the molecular formula C17H10ClF3N2O3 and a molecular weight of 382.73 g/mol. Its IUPAC name is 2-[3-[(E)-2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-cyanoethenyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[(E)-2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-cyanoethenyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 75364813 |
| Molecular Formula | C17H10ClF3N2O3 |
| Molecular Weight | 382.73 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | 2-[3-[(E)-2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-cyanoethenyl]phenoxy]acetic acid |
| SMILES | N#C/C(=C/c1cccc(OCC(=O)O)c1)c1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C17H10ClF3N2O3/c18-14-6-12(17(19,20)21)8-23-16(14)11(7-22)4-10-2-1-3-13(5-10)26-9-15(24)25/h1-6,8H,9H2,(H,24,25)/b11-4- |
| InChIKey | CXSRYFJAGCIJER-WCIBSUBMSA-N |
| XLogP | 4.28 |
| TPSA | 83.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.73 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|