C14H17BN4O5S — CID 164917897
3-[2-borono-2-[[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]acetyl]amino]ethyl]benzoic acid (PubChem CID 164917897) has the molecular formula C14H17BN4O5S and a molecular weight of 364.19 g/mol. Its IUPAC name is 3-[2-borono-2-[[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]acetyl]amino]ethyl]benzoic acid.
| Compound Name | 3-[2-borono-2-[[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]acetyl]amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 164917897 |
| Molecular Formula | C14H17BN4O5S |
| Molecular Weight | 364.19 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 3-[2-borono-2-[[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]acetyl]amino]ethyl]benzoic acid |
| SMILES | Cc1nnc(NCC(=O)NC(Cc2cccc(C(=O)O)c2)B(O)O)s1 |
| InChI | InChI=1S/C14H17BN4O5S/c1-8-18-19-14(25-8)16-7-12(20)17-11(15(23)24)6-9-3-2-4-10(5-9)13(21)22/h2-5,11,23-24H,6-7H2,1H3,(H,16,19)(H,17,20)(H,21,22) |
| InChIKey | BGRDYDDYSDFKEL-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 144.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.19 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|